C22H29N3O3 — CID 97006840
tert-butyl N-[(1S)-3-[2-(dimethylamino)anilino]-3-oxo-1-phenylpropyl]carbamate (PubChem CID 97006840) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-[2-(dimethylamino)anilino]-3-oxo-1-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-[2-(dimethylamino)anilino]-3-oxo-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 97006840 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | tert-butyl N-[(1S)-3-[2-(dimethylamino)anilino]-3-oxo-1-phenylpropyl]carbamate |
| SMILES | CN(C)c1ccccc1NC(=O)C[C@H](NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O3/c1-22(2,3)28-21(27)24-18(16-11-7-6-8-12-16)15-20(26)23-17-13-9-10-14-19(17)25(4)5/h6-14,18H,15H2,1-5H3,(H,23,26)(H,24,27)/t18-/m0/s1 |
| InChIKey | DOLQGCWIMXVDQP-SFHVURJKSA-N |
| XLogP | 4.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |