C19H18N4O2 — CID 97009757
N-[(E)-(4-hydroxy-2,3-dihydroinden-1-ylidene)amino]-2-(1-methylbenzimidazol-2-yl)acetamide (PubChem CID 97009757) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-2,3-dihydroinden-1-ylidene)amino]-2-(1-methylbenzimidazol-2-yl)acetamide.
| Compound Name | N-[(E)-(4-hydroxy-2,3-dihydroinden-1-ylidene)amino]-2-(1-methylbenzimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 97009757 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[(E)-(4-hydroxy-2,3-dihydroinden-1-ylidene)amino]-2-(1-methylbenzimidazol-2-yl)acetamide |
| SMILES | Cn1c(CC(=O)N/N=C2\CCc3c(O)cccc32)nc2ccccc21 |
| InChI | InChI=1S/C19H18N4O2/c1-23-16-7-3-2-6-15(16)20-18(23)11-19(25)22-21-14-10-9-13-12(14)5-4-8-17(13)24/h2-8,24H,9-11H2,1H3,(H,22,25)/b21-14+ |
| InChIKey | IRDBDDKRHIFAAT-KGENOOAVSA-N |
| XLogP | 2.29 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|