C8H11F3O — CID 97010124
trans-(1R,3R)-3-(trifluoromethyl)cyclohexane-1-carbaldehyde (PubChem CID 97010124) has the molecular formula C8H11F3O and a molecular weight of 180.17 g/mol. Its IUPAC name is trans-(1R,3R)-3-(trifluoromethyl)cyclohexane-1-carbaldehyde.
| Compound Name | trans-(1R,3R)-3-(trifluoromethyl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 97010124 |
| Molecular Formula | C8H11F3O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | trans-(1R,3R)-3-(trifluoromethyl)cyclohexane-1-carbaldehyde |
| SMILES | O=C[C@@H]1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C8H11F3O/c9-8(10,11)7-3-1-2-6(4-7)5-12/h5-7H,1-4H2/t6-,7-/m1/s1 |
| InChIKey | CRBMZTUNGPEXLG-RNFRBKRXSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|