C18H28N4OS — CID 97010506
(3aR,7aR)-N-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 97010506) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is (3aR,7aR)-N-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | (3aR,7aR)-N-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 97010506 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (3aR,7aR)-N-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | O=C(NCCc1csc(N2CCCC2)n1)N1CC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H28N4OS/c23-17(22-12-8-14-5-1-2-6-16(14)22)19-9-7-15-13-24-18(20-15)21-10-3-4-11-21/h13-14,16H,1-12H2,(H,19,23)/t14-,16-/m1/s1 |
| InChIKey | DUFKLHYWNMTWKD-GDBMZVCRSA-N |
| XLogP | 3.26 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |