C13H17BrN2O3 — CID 97012059
1-[(4-bromophenyl)methyl]-3-[[(2S)-1,4-dioxan-2-yl]methyl]urea (PubChem CID 97012059) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[[(2S)-1,4-dioxan-2-yl]methyl]urea.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[[(2S)-1,4-dioxan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97012059 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[[(2S)-1,4-dioxan-2-yl]methyl]urea |
| SMILES | O=C(NCc1ccc(Br)cc1)NC[C@H]1COCCO1 |
| InChI | InChI=1S/C13H17BrN2O3/c14-11-3-1-10(2-4-11)7-15-13(17)16-8-12-9-18-5-6-19-12/h1-4,12H,5-9H2,(H2,15,16,17)/t12-/m0/s1 |
| InChIKey | DQRDXWLPEPEKAF-LBPRGKRZSA-N |
| XLogP | 1.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |