C17H27N3O4 — CID 75363873
1-(adamantane-1-carbonylamino)-3-(1,4-dioxan-2-ylmethyl)urea (PubChem CID 75363873) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(adamantane-1-carbonylamino)-3-(1,4-dioxan-2-ylmethyl)urea.
| Compound Name | 1-(adamantane-1-carbonylamino)-3-(1,4-dioxan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 75363873 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-(adamantane-1-carbonylamino)-3-(1,4-dioxan-2-ylmethyl)urea |
| SMILES | O=C(NCC1COCCO1)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H27N3O4/c21-15(17-6-11-3-12(7-17)5-13(4-11)8-17)19-20-16(22)18-9-14-10-23-1-2-24-14/h11-14H,1-10H2,(H,19,21)(H2,18,20,22) |
| InChIKey | OSTLZYUXDQCCQF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|