C12H16BrN3O — CID 117235629
1-(azetidin-3-ylmethyl)-3-[(4-bromophenyl)methyl]urea (PubChem CID 117235629) has the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. Its IUPAC name is 1-(azetidin-3-ylmethyl)-3-[(4-bromophenyl)methyl]urea.
| Compound Name | 1-(azetidin-3-ylmethyl)-3-[(4-bromophenyl)methyl]urea |
|---|---|
| PubChem CID | 117235629 |
| Molecular Formula | C12H16BrN3O |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 1-(azetidin-3-ylmethyl)-3-[(4-bromophenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(Br)cc1)NCC1CNC1 |
| InChI | InChI=1S/C12H16BrN3O/c13-11-3-1-9(2-4-11)7-15-12(17)16-8-10-5-14-6-10/h1-4,10,14H,5-8H2,(H2,15,16,17) |
| InChIKey | MYGGTAZNLUPLAF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |