C20H17BrN2O4 — CID 97012161
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) (3S)-1-(4-bromophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 97012161) has the molecular formula C20H17BrN2O4 and a molecular weight of 429.27 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) (3S)-1-(4-bromophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) (3S)-1-(4-bromophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 97012161 |
| Molecular Formula | C20H17BrN2O4 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) (3S)-1-(4-bromophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C1CCc2cc(OC(=O)[C@H]3CC(=O)N(c4ccc(Br)cc4)C3)ccc2N1 |
| InChI | InChI=1S/C20H17BrN2O4/c21-14-2-4-15(5-3-14)23-11-13(10-19(23)25)20(26)27-16-6-7-17-12(9-16)1-8-18(24)22-17/h2-7,9,13H,1,8,10-11H2,(H,22,24)/t13-/m0/s1 |
| InChIKey | TWONRHKJHHTNHL-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|