C20H21N3O3 — CID 97014955
(1S,6S)-N-(4-nitrophenyl)-6-phenyl-7-azabicyclo[4.2.0]octane-7-carboxamide (PubChem CID 97014955) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (1S,6S)-N-(4-nitrophenyl)-6-phenyl-7-azabicyclo[4.2.0]octane-7-carboxamide.
| Compound Name | (1S,6S)-N-(4-nitrophenyl)-6-phenyl-7-azabicyclo[4.2.0]octane-7-carboxamide |
|---|---|
| PubChem CID | 97014955 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (1S,6S)-N-(4-nitrophenyl)-6-phenyl-7-azabicyclo[4.2.0]octane-7-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N1C[C@@H]2CCCC[C@@]21c1ccccc1 |
| InChI | InChI=1S/C20H21N3O3/c24-19(21-17-9-11-18(12-10-17)23(25)26)22-14-16-8-4-5-13-20(16,22)15-6-2-1-3-7-15/h1-3,6-7,9-12,16H,4-5,8,13-14H2,(H,21,24)/t16-,20+/m0/s1 |
| InChIKey | GVICDQOKORSRKS-OXJNMPFZSA-N |
| XLogP | 4.53 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|