C20H25N5O — CID 97158351
(1R,6S)-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-6-phenyl-7-azabicyclo[4.2.0]octane-7-carboxamide (PubChem CID 97158351) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is (1R,6S)-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-6-phenyl-7-azabicyclo[4.2.0]octane-7-carboxamide.
| Compound Name | (1R,6S)-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-6-phenyl-7-azabicyclo[4.2.0]octane-7-carboxamide |
|---|---|
| PubChem CID | 97158351 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (1R,6S)-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-6-phenyl-7-azabicyclo[4.2.0]octane-7-carboxamide |
| SMILES | O=C(NCc1nnc2n1CCC2)N1C[C@H]2CCCC[C@@]21c1ccccc1 |
| InChI | InChI=1S/C20H25N5O/c26-19(21-13-18-23-22-17-10-6-12-24(17)18)25-14-16-9-4-5-11-20(16,25)15-7-2-1-3-8-15/h1-3,7-8,16H,4-6,9-14H2,(H,21,26)/t16-,20-/m1/s1 |
| InChIKey | XHYOSGVCVISGTR-OXQOHEQNSA-N |
| XLogP | 2.84 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |