C20H19F3N2O5 — CID 97016309
(5-nitro-2-phenoxyphenyl)-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]piperidin-1-yl]methanone (PubChem CID 97016309) has the molecular formula C20H19F3N2O5 and a molecular weight of 424.38 g/mol. Its IUPAC name is (5-nitro-2-phenoxyphenyl)-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]piperidin-1-yl]methanone.
| Compound Name | (5-nitro-2-phenoxyphenyl)-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97016309 |
| Molecular Formula | C20H19F3N2O5 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (5-nitro-2-phenoxyphenyl)-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1Oc1ccccc1)N1CCC([C@@H](O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H19F3N2O5/c21-20(22,23)18(26)13-8-10-24(11-9-13)19(27)16-12-14(25(28)29)6-7-17(16)30-15-4-2-1-3-5-15/h1-7,12-13,18,26H,8-11H2/t18-/m1/s1 |
| InChIKey | ROYRUESWORVGNX-GOSISDBHSA-N |
| XLogP | 4.16 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|