C19H21FN2S — CID 97021166
(2R)-2-(3-fluorophenyl)-N-[(1R)-1-phenylethyl]pyrrolidine-1-carbothioamide (PubChem CID 97021166) has the molecular formula C19H21FN2S and a molecular weight of 328.46 g/mol. Its IUPAC name is (2R)-2-(3-fluorophenyl)-N-[(1R)-1-phenylethyl]pyrrolidine-1-carbothioamide.
| Compound Name | (2R)-2-(3-fluorophenyl)-N-[(1R)-1-phenylethyl]pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 97021166 |
| Molecular Formula | C19H21FN2S |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2R)-2-(3-fluorophenyl)-N-[(1R)-1-phenylethyl]pyrrolidine-1-carbothioamide |
| SMILES | C[C@@H](NC(=S)N1CCC[C@@H]1c1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H21FN2S/c1-14(15-7-3-2-4-8-15)21-19(23)22-12-6-11-18(22)16-9-5-10-17(20)13-16/h2-5,7-10,13-14,18H,6,11-12H2,1H3,(H,21,23)/t14-,18-/m1/s1 |
| InChIKey | BLBAFQKAHLSWPG-RDTXWAMCSA-N |
| XLogP | 4.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|