C19H26FN3O — CID 124885197
(2S)-2-(3-fluorophenyl)-N-[(1R)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]pyrrolidine-1-carboxamide (PubChem CID 124885197) has the molecular formula C19H26FN3O and a molecular weight of 331.44 g/mol. Its IUPAC name is (2S)-2-(3-fluorophenyl)-N-[(1R)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(3-fluorophenyl)-N-[(1R)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 124885197 |
| Molecular Formula | C19H26FN3O |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (2S)-2-(3-fluorophenyl)-N-[(1R)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]pyrrolidine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCC[C@H]1c1cccc(F)c1)C1=CCN(C)CC1 |
| InChI | InChI=1S/C19H26FN3O/c1-14(15-8-11-22(2)12-9-15)21-19(24)23-10-4-7-18(23)16-5-3-6-17(20)13-16/h3,5-6,8,13-14,18H,4,7,9-12H2,1-2H3,(H,21,24)/t14-,18+/m1/s1 |
| InChIKey | GEDHAVKHCJXNON-KDOFPFPSSA-N |
| XLogP | 3.32 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|