C17H20ClNO3 — CID 97030207
2-(4-chlorophenoxy)-N-[(2R)-1-(furan-3-yl)propan-2-yl]-2-methylpropanamide (PubChem CID 97030207) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(2R)-1-(furan-3-yl)propan-2-yl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(2R)-1-(furan-3-yl)propan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 97030207 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(2R)-1-(furan-3-yl)propan-2-yl]-2-methylpropanamide |
| SMILES | C[C@H](Cc1ccoc1)NC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClNO3/c1-12(10-13-8-9-21-11-13)19-16(20)17(2,3)22-15-6-4-14(18)5-7-15/h4-9,11-12H,10H2,1-3H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | DBMCGPIHKKGMAH-GFCCVEGCSA-N |
| XLogP | 3.84 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |