C11H14BrNO — CID 97036445
2-[(1R,4S)-4-bromo-2,2-dimethyl-3-oxo-1-bicyclo[2.2.1]heptanyl]acetonitrile (PubChem CID 97036445) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is 2-[(1R,4S)-4-bromo-2,2-dimethyl-3-oxo-1-bicyclo[2.2.1]heptanyl]acetonitrile.
| Compound Name | 2-[(1R,4S)-4-bromo-2,2-dimethyl-3-oxo-1-bicyclo[2.2.1]heptanyl]acetonitrile |
|---|---|
| PubChem CID | 97036445 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-[(1R,4S)-4-bromo-2,2-dimethyl-3-oxo-1-bicyclo[2.2.1]heptanyl]acetonitrile |
| SMILES | CC1(C)C(=O)[C@]2(Br)CC[C@@]1(CC#N)C2 |
| InChI | InChI=1S/C11H14BrNO/c1-9(2)8(14)11(12)4-3-10(9,7-11)5-6-13/h3-5,7H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | ZCRNYFRNZGBEHU-MNOVXSKESA-N |
| XLogP | 2.81 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|