C8H8F6O2 — CID 97049766
3-[(3R)-2,2,3,4,4,4-hexafluorobutoxy]but-3-en-2-one (PubChem CID 97049766) has the molecular formula C8H8F6O2 and a molecular weight of 250.14 g/mol. Its IUPAC name is 3-[(3R)-2,2,3,4,4,4-hexafluorobutoxy]but-3-en-2-one.
| Compound Name | 3-[(3R)-2,2,3,4,4,4-hexafluorobutoxy]but-3-en-2-one |
|---|---|
| PubChem CID | 97049766 |
| Molecular Formula | C8H8F6O2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 3-[(3R)-2,2,3,4,4,4-hexafluorobutoxy]but-3-en-2-one |
| SMILES | C=C(OCC(F)(F)[C@@H](F)C(F)(F)F)C(C)=O |
| InChI | InChI=1S/C8H8F6O2/c1-4(15)5(2)16-3-7(10,11)6(9)8(12,13)14/h6H,2-3H2,1H3/t6-/m1/s1 |
| InChIKey | GVXCWIOFPKSNTF-ZCFIWIBFSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|