C5H4N4O — CID 97056718
(7aS)-1,7a-dihydropyrazolo[4,3-d]pyrimidin-7-one (PubChem CID 97056718) has the molecular formula C5H4N4O and a molecular weight of 136.11 g/mol. Its IUPAC name is (7aS)-1,7a-dihydropyrazolo[4,3-d]pyrimidin-7-one.
| Compound Name | (7aS)-1,7a-dihydropyrazolo[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 97056718 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | (7aS)-1,7a-dihydropyrazolo[4,3-d]pyrimidin-7-one |
| SMILES | O=C1N=CN=C2C=NN[C@H]12 |
| InChI | InChI=1S/C5H4N4O/c10-5-4-3(1-8-9-4)6-2-7-5/h1-2,4,9H/t4-/m0/s1 |
| InChIKey | IHNHZSOVYAOSSK-BYPYZUCNSA-N |
| XLogP | -1.05 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |