C12H12N4 — CID 97057381
1-ethylpyrazolo[3,4-b]quinolin-3-amine (PubChem CID 97057381) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-ethylpyrazolo[3,4-b]quinolin-3-amine.
| Compound Name | 1-ethylpyrazolo[3,4-b]quinolin-3-amine |
|---|---|
| PubChem CID | 97057381 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-ethylpyrazolo[3,4-b]quinolin-3-amine |
| SMILES | CCn1nc(N)c2cc3ccccc3nc21 |
| InChI | InChI=1S/C12H12N4/c1-2-16-12-9(11(13)15-16)7-8-5-3-4-6-10(8)14-12/h3-7H,2H2,1H3,(H2,13,15) |
| InChIKey | NMZXWDRVKFKNOD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |