About 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline
3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline (PubChem CID 97060320) has the molecular formula C19H28N4O
and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline |
| PubChem CID | 97060320 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline |
| SMILES | CCn1ccnc1CNc1cccc(CN2C[C@H](C)O[C@@H](C)C2)c1 |
| InChI | InChI=1S/C19H28N4O/c1-4-23-9-8-20-19(23)11-21-18-7-5-6-17(10-18)14-22-12-15(2)24-16(3)13-22/h5-10,15-16,21H,4,11-14H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | PJZWLEKFVUKNPN-HOTGVXAUSA-N |
| XLogP | 3.12 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline?
The IUPAC name of 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline (CID 97060320) is 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline.
What is the SMILES notation for 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline?
The canonical SMILES for 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline is CCn1ccnc1CNc1cccc(CN2C[C@H](C)O[C@@H](C)C2)c1.
What is the InChIKey of 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline?
The InChIKey is PJZWLEKFVUKNPN-HOTGVXAUSA-N. The full InChI is InChI=1S/C19H28N4O/c1-4-23-9-8-20-19(23)11-21-18-7-5-6-17(10-18)14-22-12-15(2)24-16(3)13-22/h5-10,15-16,21H,4,11-14H2,1-3H3/t15-,16-/m0/s1.
What are the key properties of 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline?
3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline has a molecular weight of 328.46 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-[(1-ethylimidazol-2-yl)methyl]aniline is sourced from PubChem (CID 97060320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).