C16H23N3O2 — CID 97060768
[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-[2-(dimethylamino)-4-pyridinyl]methanone (PubChem CID 97060768) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is [(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-[2-(dimethylamino)-4-pyridinyl]methanone.
| Compound Name | [(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-[2-(dimethylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 97060768 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-[2-(dimethylamino)-4-pyridinyl]methanone |
| SMILES | CN(C)c1cc(C(=O)N2CC[C@H]3OCCC[C@@H]3C2)ccn1 |
| InChI | InChI=1S/C16H23N3O2/c1-18(2)15-10-12(5-7-17-15)16(20)19-8-6-14-13(11-19)4-3-9-21-14/h5,7,10,13-14H,3-4,6,8-9,11H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | MILQULJKVPKGMB-ZIAGYGMSSA-N |
| XLogP | 1.79 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |