C19H25N3O3 — CID 99622294
7-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-6-carbonyl]-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one (PubChem CID 99622294) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 7-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-6-carbonyl]-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one.
| Compound Name | 7-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-6-carbonyl]-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 99622294 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 7-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-6-carbonyl]-1-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
| SMILES | CN1CCC(=O)Nc2cc(C(=O)N3CC[C@H]4OCCC[C@@H]4C3)ccc21 |
| InChI | InChI=1S/C19H25N3O3/c1-21-8-7-18(23)20-15-11-13(4-5-16(15)21)19(24)22-9-6-17-14(12-22)3-2-10-25-17/h4-5,11,14,17H,2-3,6-10,12H2,1H3,(H,20,23)/t14-,17-/m1/s1 |
| InChIKey | VPUOVEXXLBXQNQ-RHSMWYFYSA-N |
| XLogP | 2.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |