C15H22N4O4 — CID 97061504
3-[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-1-methyl-1-(4-nitrophenyl)urea (PubChem CID 97061504) has the molecular formula C15H22N4O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-1-methyl-1-(4-nitrophenyl)urea.
| Compound Name | 3-[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-1-methyl-1-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 97061504 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 3-[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-1-methyl-1-(4-nitrophenyl)urea |
| SMILES | COCCN1CC[C@H](NC(=O)N(C)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C15H22N4O4/c1-17(13-3-5-14(6-4-13)19(21)22)15(20)16-12-7-8-18(11-12)9-10-23-2/h3-6,12H,7-11H2,1-2H3,(H,16,20)/t12-/m0/s1 |
| InChIKey | PECXWRJBLLSZGI-LBPRGKRZSA-N |
| XLogP | 1.46 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|