C14H23N3O4S2 — CID 164640969
3-(dimethylsulfamoyl)-N-[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 164640969) has the molecular formula C14H23N3O4S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 164640969 |
| Molecular Formula | C14H23N3O4S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | COCCN1CC[C@H](NC(=O)c2sccc2S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C14H23N3O4S2/c1-16(2)23(19,20)12-5-9-22-13(12)14(18)15-11-4-6-17(10-11)7-8-21-3/h5,9,11H,4,6-8,10H2,1-3H3,(H,15,18)/t11-/m0/s1 |
| InChIKey | IVBRPOMMMACMOB-NSHDSACASA-N |
| XLogP | 0.45 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |