About (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one
(2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one (PubChem CID 97063042) has the molecular formula C17H22FNO4S
and a molecular weight of 355.43 g/mol. Its IUPAC name is (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one.
Molecular Properties
| Compound Name | (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one |
| PubChem CID | 97063042 |
| Molecular Formula | C17H22FNO4S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one |
| SMILES | C[C@H](C(=O)N1CCCc2cccc(F)c21)S(=O)(=O)C1CCOCC1 |
| InChI | InChI=1S/C17H22FNO4S/c1-12(24(21,22)14-7-10-23-11-8-14)17(20)19-9-3-5-13-4-2-6-15(18)16(13)19/h2,4,6,12,14H,3,5,7-11H2,1H3/t12-/m1/s1 |
| InChIKey | KFCSUMDOQBLCJL-GFCCVEGCSA-N |
| XLogP | 2.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one?
The IUPAC name of (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one (CID 97063042) is (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one.
What is the SMILES notation for (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one?
The canonical SMILES for (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one is C[C@H](C(=O)N1CCCc2cccc(F)c21)S(=O)(=O)C1CCOCC1.
What is the InChIKey of (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one?
The InChIKey is KFCSUMDOQBLCJL-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H22FNO4S/c1-12(24(21,22)14-7-10-23-11-8-14)17(20)19-9-3-5-13-4-2-6-15(18)16(13)19/h2,4,6,12,14H,3,5,7-11H2,1H3/t12-/m1/s1.
What are the key properties of (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one?
(2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one has a molecular weight of 355.43 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)-2-(oxan-4-ylsulfonyl)propan-1-one is sourced from PubChem (CID 97063042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).