C21H26N4O5S — CID 97069813
2-[(2S)-1-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]piperidin-2-yl]acetamide (PubChem CID 97069813) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-[(2S)-1-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]piperidin-2-yl]acetamide.
| Compound Name | 2-[(2S)-1-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]piperidin-2-yl]acetamide |
|---|---|
| PubChem CID | 97069813 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[(2S)-1-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]piperidin-2-yl]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N3CCCC[C@H]3CC(N)=O)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C21H26N4O5S/c1-14-6-8-18(15(2)11-14)23-31(29,30)17-7-9-19(20(13-17)25(27)28)24-10-4-3-5-16(24)12-21(22)26/h6-9,11,13,16,23H,3-5,10,12H2,1-2H3,(H2,22,26)/t16-/m0/s1 |
| InChIKey | PLQHRZIVONFFIZ-INIZCTEOSA-N |
| XLogP | 3.25 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|