C23H31N5O5S — CID 55370441
2-[4-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 55370441) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-[4-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55370441 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[4-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N3CCN(CC(=O)NC(C)C)CC3)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C23H31N5O5S/c1-16(2)24-23(29)15-26-9-11-27(12-10-26)21-8-6-19(14-22(21)28(30)31)34(32,33)25-20-7-5-17(3)13-18(20)4/h5-8,13-14,16,25H,9-12,15H2,1-4H3,(H,24,29) |
| InChIKey | IHJAONWZYWIYTN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|