C20H27N5O6S2 — CID 52910102
N-(2,4-dimethylphenyl)-3-nitro-4-[(3S)-3-[(sulfamoylamino)methyl]piperidin-1-yl]benzenesulfonamide (PubChem CID 52910102) has the molecular formula C20H27N5O6S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-nitro-4-[(3S)-3-[(sulfamoylamino)methyl]piperidin-1-yl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-nitro-4-[(3S)-3-[(sulfamoylamino)methyl]piperidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 52910102 |
| Molecular Formula | C20H27N5O6S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-nitro-4-[(3S)-3-[(sulfamoylamino)methyl]piperidin-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N3CCC[C@H](CNS(N)(=O)=O)C3)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C20H27N5O6S2/c1-14-5-7-18(15(2)10-14)23-32(28,29)17-6-8-19(20(11-17)25(26)27)24-9-3-4-16(13-24)12-22-33(21,30)31/h5-8,10-11,16,22-23H,3-4,9,12-13H2,1-2H3,(H2,21,30,31)/t16-/m1/s1 |
| InChIKey | ZFPOVGVIDDWOCV-MRXNPFEDSA-N |
| XLogP | 2.02 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|