C19H27N5O — CID 97071157
[4-(6-methylpyridazin-3-yl)-1,4-diazepan-1-yl]-[(2S)-1-prop-2-ynylpiperidin-2-yl]methanone (PubChem CID 97071157) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is [4-(6-methylpyridazin-3-yl)-1,4-diazepan-1-yl]-[(2S)-1-prop-2-ynylpiperidin-2-yl]methanone.
| Compound Name | [4-(6-methylpyridazin-3-yl)-1,4-diazepan-1-yl]-[(2S)-1-prop-2-ynylpiperidin-2-yl]methanone |
|---|---|
| PubChem CID | 97071157 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | [4-(6-methylpyridazin-3-yl)-1,4-diazepan-1-yl]-[(2S)-1-prop-2-ynylpiperidin-2-yl]methanone |
| SMILES | C#CCN1CCCC[C@H]1C(=O)N1CCCN(c2ccc(C)nn2)CC1 |
| InChI | InChI=1S/C19H27N5O/c1-3-10-22-11-5-4-7-17(22)19(25)24-13-6-12-23(14-15-24)18-9-8-16(2)20-21-18/h1,8-9,17H,4-7,10-15H2,2H3/t17-/m0/s1 |
| InChIKey | MMBNWKFZAOFBQK-KRWDZBQOSA-N |
| XLogP | 1.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|