C24H39N3O4 — CID 97079456
tert-butyl N-[(2R)-2-[[3-(3-cyanopropoxy)-4-methoxyphenyl]methylamino]-2,4-dimethylpentyl]carbamate (PubChem CID 97079456) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[[3-(3-cyanopropoxy)-4-methoxyphenyl]methylamino]-2,4-dimethylpentyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[[3-(3-cyanopropoxy)-4-methoxyphenyl]methylamino]-2,4-dimethylpentyl]carbamate |
|---|---|
| PubChem CID | 97079456 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | tert-butyl N-[(2R)-2-[[3-(3-cyanopropoxy)-4-methoxyphenyl]methylamino]-2,4-dimethylpentyl]carbamate |
| SMILES | COc1ccc(CN[C@@](C)(CNC(=O)OC(C)(C)C)CC(C)C)cc1OCCCC#N |
| InChI | InChI=1S/C24H39N3O4/c1-18(2)15-24(6,17-26-22(28)31-23(3,4)5)27-16-19-10-11-20(29-7)21(14-19)30-13-9-8-12-25/h10-11,14,18,27H,8-9,13,15-17H2,1-7H3,(H,26,28)/t24-/m1/s1 |
| InChIKey | OCDQDRTYEDCPHF-XMMPIXPASA-N |
| XLogP | 4.80 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|