C18H29NO2 — CID 97080184
N-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]adamantane-2-carboxamide (PubChem CID 97080184) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]adamantane-2-carboxamide.
| Compound Name | N-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]adamantane-2-carboxamide |
|---|---|
| PubChem CID | 97080184 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-[(1R,2R)-2-(hydroxymethyl)cyclohexyl]adamantane-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1CO)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H29NO2/c20-10-13-3-1-2-4-16(13)19-18(21)17-14-6-11-5-12(8-14)9-15(17)7-11/h11-17,20H,1-10H2,(H,19,21)/t11?,12?,13-,14?,15?,16+,17?/m0/s1 |
| InChIKey | ASBZVWNNPHZCAK-ZNMWDQDHSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |