C18H23F2NO3 — CID 97083131
N-[4-(2,4-difluorophenyl)oxan-4-yl]-3-[(2S)-oxolan-2-yl]propanamide (PubChem CID 97083131) has the molecular formula C18H23F2NO3 and a molecular weight of 339.38 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenyl)oxan-4-yl]-3-[(2S)-oxolan-2-yl]propanamide.
| Compound Name | N-[4-(2,4-difluorophenyl)oxan-4-yl]-3-[(2S)-oxolan-2-yl]propanamide |
|---|---|
| PubChem CID | 97083131 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[4-(2,4-difluorophenyl)oxan-4-yl]-3-[(2S)-oxolan-2-yl]propanamide |
| SMILES | O=C(CC[C@@H]1CCCO1)NC1(c2ccc(F)cc2F)CCOCC1 |
| InChI | InChI=1S/C18H23F2NO3/c19-13-3-5-15(16(20)12-13)18(7-10-23-11-8-18)21-17(22)6-4-14-2-1-9-24-14/h3,5,12,14H,1-2,4,6-11H2,(H,21,22)/t14-/m0/s1 |
| InChIKey | UZHKTDLGKIRGKI-AWEZNQCLSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |