C19H19F2NO3 — CID 97248230
(2R)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-hydroxy-2-phenylacetamide (PubChem CID 97248230) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is (2R)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2R)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 97248230 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (2R)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(NC1(c2ccc(F)cc2F)CCOCC1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H19F2NO3/c20-14-6-7-15(16(21)12-14)19(8-10-25-11-9-19)22-18(24)17(23)13-4-2-1-3-5-13/h1-7,12,17,23H,8-11H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | KVMCDLKJMIVNMV-QGZVFWFLSA-N |
| XLogP | 2.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |