C20H19F2N3O2 — CID 126785654
1-[4-(2,4-difluorophenyl)oxan-4-yl]-3-(1H-indol-6-yl)urea (PubChem CID 126785654) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenyl)oxan-4-yl]-3-(1H-indol-6-yl)urea.
| Compound Name | 1-[4-(2,4-difluorophenyl)oxan-4-yl]-3-(1H-indol-6-yl)urea |
|---|---|
| PubChem CID | 126785654 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-[4-(2,4-difluorophenyl)oxan-4-yl]-3-(1H-indol-6-yl)urea |
| SMILES | O=C(Nc1ccc2cc[nH]c2c1)NC1(c2ccc(F)cc2F)CCOCC1 |
| InChI | InChI=1S/C20H19F2N3O2/c21-14-2-4-16(17(22)11-14)20(6-9-27-10-7-20)25-19(26)24-15-3-1-13-5-8-23-18(13)12-15/h1-5,8,11-12,23H,6-7,9-10H2,(H2,24,25,26) |
| InChIKey | MBTRJYUQLOTSKK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |