C21H21F2NO4 — CID 120551325
2-[3-[[4-(2,4-difluorophenyl)oxan-4-yl]amino]-3-oxopropyl]benzoic acid (PubChem CID 120551325) has the molecular formula C21H21F2NO4 and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-[3-[[4-(2,4-difluorophenyl)oxan-4-yl]amino]-3-oxopropyl]benzoic acid.
| Compound Name | 2-[3-[[4-(2,4-difluorophenyl)oxan-4-yl]amino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 120551325 |
| Molecular Formula | C21H21F2NO4 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[3-[[4-(2,4-difluorophenyl)oxan-4-yl]amino]-3-oxopropyl]benzoic acid |
| SMILES | O=C(CCc1ccccc1C(=O)O)NC1(c2ccc(F)cc2F)CCOCC1 |
| InChI | InChI=1S/C21H21F2NO4/c22-15-6-7-17(18(23)13-15)21(9-11-28-12-10-21)24-19(25)8-5-14-3-1-2-4-16(14)20(26)27/h1-4,6-7,13H,5,8-12H2,(H,24,25)(H,26,27) |
| InChIKey | IELDNNPJDBBBQO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |