C16H21N3O2 — CID 97084942
[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2-cyclopropylpyrimidin-4-yl)methanone (PubChem CID 97084942) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2-cyclopropylpyrimidin-4-yl)methanone.
| Compound Name | [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2-cyclopropylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 97084942 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-(2-cyclopropylpyrimidin-4-yl)methanone |
| SMILES | O=C(c1ccnc(C2CC2)n1)N1CC[C@@H]2OCCC[C@@H]2C1 |
| InChI | InChI=1S/C16H21N3O2/c20-16(13-5-7-17-15(18-13)11-3-4-11)19-8-6-14-12(10-19)2-1-9-21-14/h5,7,11-12,14H,1-4,6,8-10H2/t12-,14+/m1/s1 |
| InChIKey | GONFGMYGNWXTAE-OCCSQVGLSA-N |
| XLogP | 2.00 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |