C12H17NO2S2 — CID 97088501
2-methylsulfanyl-N-[(1S)-1-[4-[(R)-methylsulfinyl]phenyl]ethyl]acetamide (PubChem CID 97088501) has the molecular formula C12H17NO2S2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[(1S)-1-[4-[(R)-methylsulfinyl]phenyl]ethyl]acetamide.
| Compound Name | 2-methylsulfanyl-N-[(1S)-1-[4-[(R)-methylsulfinyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 97088501 |
| Molecular Formula | C12H17NO2S2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-methylsulfanyl-N-[(1S)-1-[4-[(R)-methylsulfinyl]phenyl]ethyl]acetamide |
| SMILES | CSCC(=O)N[C@@H](C)c1ccc([S@@](C)=O)cc1 |
| InChI | InChI=1S/C12H17NO2S2/c1-9(13-12(14)8-16-2)10-4-6-11(7-5-10)17(3)15/h4-7,9H,8H2,1-3H3,(H,13,14)/t9-,17+/m0/s1 |
| InChIKey | HTQBMYLCKAQZEA-HUTHGQBESA-N |
| XLogP | 1.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |