C17H24N4O2 — CID 97089215
(5R)-3,5-dimethyl-5-[(3S)-1-[(1R)-1-pyridin-3-ylethyl]piperidin-3-yl]imidazolidine-2,4-dione (PubChem CID 97089215) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is (5R)-3,5-dimethyl-5-[(3S)-1-[(1R)-1-pyridin-3-ylethyl]piperidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3,5-dimethyl-5-[(3S)-1-[(1R)-1-pyridin-3-ylethyl]piperidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97089215 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (5R)-3,5-dimethyl-5-[(3S)-1-[(1R)-1-pyridin-3-ylethyl]piperidin-3-yl]imidazolidine-2,4-dione |
| SMILES | C[C@H](c1cccnc1)N1CCC[C@H]([C@@]2(C)NC(=O)N(C)C2=O)C1 |
| InChI | InChI=1S/C17H24N4O2/c1-12(13-6-4-8-18-10-13)21-9-5-7-14(11-21)17(2)15(22)20(3)16(23)19-17/h4,6,8,10,12,14H,5,7,9,11H2,1-3H3,(H,19,23)/t12-,14+,17-/m1/s1 |
| InChIKey | YENIODIGEGUDNM-HACGYAERSA-N |
| XLogP | 1.79 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|