C13H20F3N3OS — CID 97095547
2,2,2-trifluoro-N-[3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]propyl]acetamide (PubChem CID 97095547) has the molecular formula C13H20F3N3OS and a molecular weight of 323.38 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 97095547 |
| Molecular Formula | C13H20F3N3OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]propyl]acetamide |
| SMILES | CC[C@](C)(NCCCNC(=O)C(F)(F)F)c1nc(C)cs1 |
| InChI | InChI=1S/C13H20F3N3OS/c1-4-12(3,11-19-9(2)8-21-11)18-7-5-6-17-10(20)13(14,15)16/h8,18H,4-7H2,1-3H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | ZSHVREOBJJDYCA-LBPRGKRZSA-N |
| XLogP | 2.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|