C11H17N3O3 — CID 97097939
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[(2S)-pentan-2-yl]acetamide (PubChem CID 97097939) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[(2S)-pentan-2-yl]acetamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[(2S)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 97097939 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[(2S)-pentan-2-yl]acetamide |
| SMILES | CCC[C@H](C)NC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C11H17N3O3/c1-3-4-8(2)12-10(16)7-14-11(17)6-5-9(15)13-14/h5-6,8H,3-4,7H2,1-2H3,(H,12,16)(H,13,15)/t8-/m0/s1 |
| InChIKey | KVNAICXWFRLLQN-QMMMGPOBSA-N |
| XLogP | -0.16 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |