C20H28N6O6 — CID 4254899
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[2-[2-(3,6-dioxo-1H-pyridazin-2-yl)pentanoylamino]ethyl]pentanamide (PubChem CID 4254899) has the molecular formula C20H28N6O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[2-[2-(3,6-dioxo-1H-pyridazin-2-yl)pentanoylamino]ethyl]pentanamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[2-[2-(3,6-dioxo-1H-pyridazin-2-yl)pentanoylamino]ethyl]pentanamide |
|---|---|
| PubChem CID | 4254899 |
| Molecular Formula | C20H28N6O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[2-[2-(3,6-dioxo-1H-pyridazin-2-yl)pentanoylamino]ethyl]pentanamide |
| SMILES | CCCC(C(=O)NCCNC(=O)C(CCC)n1[nH]c(=O)ccc1=O)n1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C20H28N6O6/c1-3-5-13(25-17(29)9-7-15(27)23-25)19(31)21-11-12-22-20(32)14(6-4-2)26-18(30)10-8-16(28)24-26/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,21,31)(H,22,32)(H,23,27)(H,24,28) |
| InChIKey | WTYUJSAKHUAXLS-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 167.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|