C16H26N6O5 — CID 134398790
(2S)-5-(carbamoylamino)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)amino]-3-methylbutanoyl]amino]-N-methylpentanamide (PubChem CID 134398790) has the molecular formula C16H26N6O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)amino]-3-methylbutanoyl]amino]-N-methylpentanamide.
| Compound Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)amino]-3-methylbutanoyl]amino]-N-methylpentanamide |
|---|---|
| PubChem CID | 134398790 |
| Molecular Formula | C16H26N6O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)amino]-3-methylbutanoyl]amino]-N-methylpentanamide |
| SMILES | CNC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C16H26N6O5/c1-9(2)13(21-22-11(23)6-7-12(22)24)15(26)20-10(14(25)18-3)5-4-8-19-16(17)27/h6-7,9-10,13,21H,4-5,8H2,1-3H3,(H,18,25)(H,20,26)(H3,17,19,27)/t10-,13-/m0/s1 |
| InChIKey | POOKTFGATZYDMO-GWCFXTLKSA-N |
| XLogP | -1.88 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|