C22H35N5O6 — CID 72621676
N-[1-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 72621676) has the molecular formula C22H35N5O6 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[1-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[1-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 72621676 |
| Molecular Formula | C22H35N5O6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[1-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C22H35N5O6/c1-14(2)20(21(32)25-16(15(3)28)8-7-12-24-22(23)33)26-17(29)9-5-4-6-13-27-18(30)10-11-19(27)31/h10-11,14,16,20H,4-9,12-13H2,1-3H3,(H,25,32)(H,26,29)(H3,23,24,33) |
| InChIKey | BACVBGUTBCOVJR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|