C16H26N4O4 — CID 130377219
(2S)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)-methylamino]-3-methylbutanoyl]amino]-N,3-dimethylbutanamide (PubChem CID 130377219) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)-methylamino]-3-methylbutanoyl]amino]-N,3-dimethylbutanamide.
| Compound Name | (2S)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)-methylamino]-3-methylbutanoyl]amino]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 130377219 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)-methylamino]-3-methylbutanoyl]amino]-N,3-dimethylbutanamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)N1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C16H26N4O4/c1-9(2)13(15(23)17-5)18-16(24)14(10(3)4)19(6)20-11(21)7-8-12(20)22/h7-10,13-14H,1-6H3,(H,17,23)(H,18,24)/t13-,14-/m0/s1 |
| InChIKey | AZHFODCZUFTUNZ-KBPBESRZSA-N |
| XLogP | -0.33 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|