C19H30N4O5 — CID 122491036
6-(2,5-dioxopyrrol-1-yl)-N-[3-methyl-1-[[(2S)-1-(methylamino)-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]hexanamide (PubChem CID 122491036) has the molecular formula C19H30N4O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[3-methyl-1-[[(2S)-1-(methylamino)-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[3-methyl-1-[[(2S)-1-(methylamino)-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 122491036 |
| Molecular Formula | C19H30N4O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[3-methyl-1-[[(2S)-1-(methylamino)-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]hexanamide |
| SMILES | CNC(=O)[C@H](C)NC(=O)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C19H30N4O5/c1-12(2)17(19(28)21-13(3)18(27)20-4)22-14(24)8-6-5-7-11-23-15(25)9-10-16(23)26/h9-10,12-13,17H,5-8,11H2,1-4H3,(H,20,27)(H,21,28)(H,22,24)/t13-,17?/m0/s1 |
| InChIKey | UZEVQCJYXFEYPQ-CWQZNGJJSA-N |
| XLogP | -0.14 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|