C17H28N4O4 — CID 70643573
2-(dimethylamino)-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-4-methylpentanamide (PubChem CID 70643573) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-4-methylpentanamide.
| Compound Name | 2-(dimethylamino)-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 70643573 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 2-(dimethylamino)-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)N(C)C |
| InChI | InChI=1S/C17H28N4O4/c1-12(2)11-13(20(3)4)17(25)19-9-8-18-14(22)7-10-21-15(23)5-6-16(21)24/h5-6,12-13H,7-11H2,1-4H3,(H,18,22)(H,19,25) |
| InChIKey | RRRKQGCDTGSQRO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|