C11H14N4O4 — CID 63554067
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(6-oxopiperidin-3-yl)acetamide (PubChem CID 63554067) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(6-oxopiperidin-3-yl)acetamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(6-oxopiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 63554067 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(6-oxopiperidin-3-yl)acetamide |
| SMILES | O=C1CCC(NC(=O)Cn2[nH]c(=O)ccc2=O)CN1 |
| InChI | InChI=1S/C11H14N4O4/c16-8-2-1-7(5-12-8)13-10(18)6-15-11(19)4-3-9(17)14-15/h3-4,7H,1-2,5-6H2,(H,12,16)(H,13,18)(H,14,17) |
| InChIKey | BAKSLOUSZUMMKW-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |