C20H26N6O6 — CID 140664694
3,6-bis[4-[(2,5-dioxopyrrol-1-yl)amino]butyl]piperazine-2,5-dione (PubChem CID 140664694) has the molecular formula C20H26N6O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 3,6-bis[4-[(2,5-dioxopyrrol-1-yl)amino]butyl]piperazine-2,5-dione.
| Compound Name | 3,6-bis[4-[(2,5-dioxopyrrol-1-yl)amino]butyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 140664694 |
| Molecular Formula | C20H26N6O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3,6-bis[4-[(2,5-dioxopyrrol-1-yl)amino]butyl]piperazine-2,5-dione |
| SMILES | O=C1NC(CCCCNN2C(=O)C=CC2=O)C(=O)NC1CCCCNN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H26N6O6/c27-15-7-8-16(28)25(15)21-11-3-1-5-13-19(31)24-14(20(32)23-13)6-2-4-12-22-26-17(29)9-10-18(26)30/h7-10,13-14,21-22H,1-6,11-12H2,(H,23,32)(H,24,31) |
| InChIKey | MNDUYGOQWYFESA-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|