C16H23N3O4 — CID 142798185
(2R)-1-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]piperidine-2-carboxamide (PubChem CID 142798185) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2R)-1-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 142798185 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2R)-1-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]piperidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCCN1C(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H23N3O4/c17-16(23)12-6-3-5-10-18(12)13(20)7-2-1-4-11-19-14(21)8-9-15(19)22/h8-9,12H,1-7,10-11H2,(H2,17,23)/t12-/m1/s1 |
| InChIKey | JGUHCQRSVFYSNK-GFCCVEGCSA-N |
| XLogP | 0.34 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|