C20H26N4O5 — CID 141399564
1-[4-[5-[4-(2,5-dioxopyrrol-1-yl)butyl]-6-oxopiperazin-2-yl]butyl]pyrrole-2,5-dione (PubChem CID 141399564) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-[4-[5-[4-(2,5-dioxopyrrol-1-yl)butyl]-6-oxopiperazin-2-yl]butyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[5-[4-(2,5-dioxopyrrol-1-yl)butyl]-6-oxopiperazin-2-yl]butyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141399564 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[4-[5-[4-(2,5-dioxopyrrol-1-yl)butyl]-6-oxopiperazin-2-yl]butyl]pyrrole-2,5-dione |
| SMILES | O=C1NC(CCCCN2C(=O)C=CC2=O)CNC1CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H26N4O5/c25-16-7-8-17(26)23(16)11-3-1-5-14-13-21-15(20(29)22-14)6-2-4-12-24-18(27)9-10-19(24)28/h7-10,14-15,21H,1-6,11-13H2,(H,22,29) |
| InChIKey | DAAJWHCGPADIJG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|