C12H16N4O4 — CID 154773743
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-oxoazepan-3-yl)acetamide (PubChem CID 154773743) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-oxoazepan-3-yl)acetamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-oxoazepan-3-yl)acetamide |
|---|---|
| PubChem CID | 154773743 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-oxoazepan-3-yl)acetamide |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)NC1CCCCNC1=O |
| InChI | InChI=1S/C12H16N4O4/c17-9-4-5-11(19)16(15-9)7-10(18)14-8-3-1-2-6-13-12(8)20/h4-5,8H,1-3,6-7H2,(H,13,20)(H,14,18)(H,15,17) |
| InChIKey | SEFGZOZEUQRSBX-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |